CAS 898756-16-6
:1-(3,4-dimethoxyphenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one
Description:
1-(3,4-Dimethoxyphenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one, with the CAS number 898756-16-6, is a synthetic organic compound characterized by its complex structure, which includes a butanone moiety and a substituted phenyl group. The presence of the 3,4-dimethoxyphenyl group suggests potential aromatic properties, while the 5,5-dimethyl-1,3-dioxan-2-yl component indicates a cyclic ether structure that may contribute to its stability and solubility in organic solvents. This compound may exhibit interesting biological activities due to its unique functional groups, making it a candidate for research in medicinal chemistry. Its molecular structure implies potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of methoxy groups can enhance lipophilicity, influencing its pharmacokinetic properties. As with many synthetic compounds, safety data and handling precautions should be considered, particularly regarding its reactivity and potential toxicity. Overall, this compound represents a fascinating subject for further study in both synthetic and medicinal chemistry contexts.
Formula:C18H26O5
InChI:InChI=1/C18H26O5/c1-18(2)11-22-17(23-12-18)7-5-6-14(19)13-8-9-15(20-3)16(10-13)21-4/h8-10,17H,5-7,11-12H2,1-4H3
SMILES:CC1(C)COC(CCCC(=O)c2ccc(c(c2)OC)OC)OC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.