CymitQuimica logo

CAS 898756-17-7

:

(4-bromo-3-fluoro-phenyl)-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methanone

Description:
The chemical substance known as (4-bromo-3-fluoro-phenyl)-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methanone, with the CAS number 898756-17-7, is a complex organic compound characterized by its unique structural features. It contains a phenyl ring substituted with bromine and fluorine atoms, which can influence its reactivity and interaction with biological systems. The presence of a spirocyclic structure, specifically the 1,4-dioxa-8-azaspiro framework, suggests potential applications in medicinal chemistry, particularly in drug design, due to its ability to modulate biological activity. The methanone functional group indicates that it may exhibit ketone-like properties, contributing to its chemical reactivity. Overall, this compound's intricate structure may lead to interesting pharmacological properties, making it a candidate for further research in the fields of organic synthesis and medicinal chemistry. However, specific physical and chemical properties such as solubility, melting point, and stability would require empirical data for comprehensive characterization.
Formula:C21H21BrFNO3
InChI:InChI=1/C21H21BrFNO3/c22-18-6-5-15(13-19(18)23)20(25)17-4-2-1-3-16(17)14-24-9-7-21(8-10-24)26-11-12-27-21/h1-6,13H,7-12,14H2
SMILES:c1ccc(c(c1)CN1CCC2(CC1)OCCO2)C(=O)c1ccc(c(c1)F)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.