CymitQuimica logo

CAS 898756-21-3

:

1-(3,5-Dimethoxyphenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-butanone

Description:
1-(3,5-Dimethoxyphenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-butanone, with the CAS number 898756-21-3, is an organic compound characterized by its complex structure that includes a butanone moiety and a dioxane ring. The presence of the 3,5-dimethoxyphenyl group contributes to its potential aromatic properties, while the dioxane component may impart unique solubility and stability characteristics. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic and hydrophilic dioxane functionalities. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a synthetic intermediate. The presence of methoxy groups can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the compound's stability and reactivity may be affected by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, this compound represents a unique blend of functional groups that may offer diverse chemical behavior and potential utility in various fields.
Formula:C18H26O5
InChI:InChI=1S/C18H26O5/c1-18(2)11-22-17(23-12-18)7-5-6-16(19)13-8-14(20-3)10-15(9-13)21-4/h8-10,17H,5-7,11-12H2,1-4H3
InChI key:InChIKey=AWFSMLQPFQRKMM-UHFFFAOYSA-N
SMILES:C(CCCC1OCC(C)(C)CO1)(=O)C2=CC(OC)=CC(OC)=C2
Synonyms:
  • 1-(3,5-Dimethoxyphenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-butanone
  • 1-Butanone, 1-(3,5-dimethoxyphenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.