CAS 898756-22-4

Methanone, (2-chlorophenyl)[2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

Description:

Methanone, (2-chlorophenyl)[2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique structural features, including a methanone functional group and a spirocyclic structure. The presence of a 2-chlorophenyl group indicates that it contains a chlorine atom attached to a phenyl ring, which can influence its reactivity and biological activity. The compound also features a dioxa-azaspiro structure, suggesting it has a bicyclic framework that incorporates both oxygen and nitrogen atoms, contributing to its potential pharmacological properties. Such compounds are often investigated for their applications in medicinal chemistry, particularly in the development of new therapeutic agents. The molecular interactions, solubility, and stability of this compound can be influenced by its functional groups and overall molecular geometry. As with many organic compounds, its behavior in biological systems, including potential toxicity and efficacy, would require thorough investigation through experimental studies.

Formula: C₂₁H₂₂ClNO₃

InChI: InChI=1S/C21H22ClNO3/c22-19-8-4-3-7-18(19)20(24)17-6-2-1-5-16(17)15-23-11-9-21(10-12-23)25-13-14-26-21/h1-8H,9-15H2

InChI key: InChIKey=MENXPWLPHGGFQX-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=C(C(=O)C4=C(Cl)C=CC=C4)C=CC=C3

Synonyms:

• (2-Chlorophenyl)[2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]methanone
• Methanone, (2-chlorophenyl)[2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

2-chloro-2′-[8-(1,4-dioxa-8-azaspiro[4.5]decyl)methyl]benzophenone

CAS: 898756-22-4

Formula: C₂₁H₂₂ClNO₃

Purity: 97.0%

Molecular weight: 371.86

Ref: 10-F205367