CymitQuimica logo

CAS 898756-26-8

:

3-(1,3-Dioxan-2-yl)-1-(1-naphthalenyl)-1-propanone

Description:
3-(1,3-Dioxan-2-yl)-1-(1-naphthalenyl)-1-propanone, identified by its CAS number 898756-26-8, is an organic compound characterized by its complex structure that includes a dioxane ring and a naphthalene moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in organic synthesis and materials science. The presence of the dioxane ring suggests it may have good solubility in polar organic solvents, while the naphthalene group can impart stability and influence the compound's electronic properties. Additionally, the ketone functional group in the propanone structure may participate in various chemical reactions, such as nucleophilic additions or reductions. Overall, this compound's unique structural features make it of interest in fields such as medicinal chemistry and organic synthesis, where it may serve as a building block for more complex molecules or as a potential pharmacophore in drug development.
Formula:C17H18O3
InChI:InChI=1S/C17H18O3/c18-16(9-10-17-19-11-4-12-20-17)15-8-3-6-13-5-1-2-7-14(13)15/h1-3,5-8,17H,4,9-12H2
InChI key:InChIKey=ADBCWCOCPHMEOZ-UHFFFAOYSA-N
SMILES:C(CCC1OCCCO1)(=O)C=2C3=C(C=CC2)C=CC=C3
Synonyms:
  • 3-(1,3-Dioxan-2-yl)-1-(1-naphthalenyl)-1-propanone
  • 1-Propanone, 3-(1,3-dioxan-2-yl)-1-(1-naphthalenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.