CAS 898756-27-9

[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]-[2-(trifluoromethyl)phenyl]methanone

Description:

The chemical substance known as [2-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]-[2-(trifluoromethyl)phenyl]methanone, with the CAS number 898756-27-9, is characterized by its complex molecular structure, which includes a spirocyclic framework and multiple functional groups. The presence of a trifluoromethyl group indicates potential for increased lipophilicity and biological activity, while the dioxa and azaspiro components suggest unique interactions in biological systems. This compound may exhibit properties such as moderate to high stability under standard conditions, and its solubility can vary depending on the solvent used, influenced by the polar and nonpolar characteristics of its substituents. Additionally, the presence of the methanone functional group implies potential reactivity in various chemical reactions, including nucleophilic attacks. Its unique structure may also confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its physical and chemical properties, as well as its potential applications.

Formula: C₂₂H₂₂F₃NO₃

InChI: InChI=1/C22H22F3NO3/c23-22(24,25)19-8-4-3-7-18(19)20(27)17-6-2-1-5-16(17)15-26-11-9-21(10-12-26)28-13-14-29-21/h1-8H,9-15H2

SMILES: c1ccc(c(c1)CN1CCC2(CC1)OCCO2)C(=O)c1ccccc1C(F)(F)F