CymitQuimica logo

CAS 898756-29-1

:

4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(1-naphthalenyl)-1-butanone

Description:
4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(1-naphthalenyl)-1-butanone, with the CAS number 898756-29-1, is a synthetic organic compound characterized by its complex molecular structure, which includes a dioxane ring and a naphthalene moiety. This compound typically exhibits properties associated with ketones, such as being a polar substance with potential solubility in organic solvents. The presence of the dioxane ring may contribute to its stability and influence its reactivity, while the naphthalene group can impart aromatic characteristics, potentially affecting its interactions with other molecules. The compound may be of interest in various fields, including organic synthesis and materials science, due to its unique structural features. Additionally, its potential applications could extend to pharmaceuticals or as a building block in the development of more complex chemical entities. However, specific physical properties such as boiling point, melting point, and spectral data would require empirical measurement or detailed literature references for precise characterization.
Formula:C20H24O3
InChI:InChI=1S/C20H24O3/c1-20(2)13-22-19(23-14-20)12-6-11-18(21)17-10-5-8-15-7-3-4-9-16(15)17/h3-5,7-10,19H,6,11-14H2,1-2H3
InChI key:InChIKey=AWMBYCKPMJGYHI-UHFFFAOYSA-N
SMILES:C(CCCC1OCC(C)(C)CO1)(=O)C=2C3=C(C=CC2)C=CC=C3
Synonyms:
  • 1-Butanone, 4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(1-naphthalenyl)-
  • 4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(1-naphthalenyl)-1-butanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.