CAS 898756-30-4

[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]-[3-(trifluoromethyl)phenyl]methanone

Description:

The chemical substance known as [2-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]-[3-(trifluoromethyl)phenyl]methanone, with the CAS number 898756-30-4, is characterized by its complex molecular structure, which includes a spirocyclic moiety and a trifluoromethyl group. This compound features a phenyl ring substituted with a methanone functional group, contributing to its potential reactivity and applications in organic synthesis. The presence of the 1,4-dioxa and azaspiro structures suggests interesting properties related to its stability and interaction with biological systems. Additionally, the trifluoromethyl group is known for enhancing lipophilicity and metabolic stability, which may influence the compound's pharmacokinetic properties. Such characteristics make it a candidate for research in medicinal chemistry, particularly in the development of pharmaceuticals. Its unique structural features may also impart specific biological activities, warranting further investigation into its potential applications in drug discovery and development.

Formula: C₂₂H₂₂F₃NO₃

InChI: InChI=1/C22H22F3NO3/c23-22(24,25)18-6-3-5-16(14-18)20(27)19-7-2-1-4-17(19)15-26-10-8-21(9-11-26)28-12-13-29-21/h1-7,14H,8-13,15H2

SMILES: c1ccc(c(c1)CN1CCC2(CC1)OCCO2)C(=O)c1cccc(c1)C(F)(F)F