CAS 898756-33-7

[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone

Description:

The chemical substance known as [2-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone, with the CAS number 898756-33-7, is characterized by its complex molecular structure, which includes a spirocyclic moiety and a trifluoromethyl group. This compound features a phenyl ring substituted with a trifluoromethyl group, which is known to enhance lipophilicity and biological activity. The presence of the 1,4-dioxa and azaspiro components suggests potential applications in medicinal chemistry, particularly in drug design, due to their ability to interact with biological targets. The methanone functional group indicates that it may exhibit reactivity typical of ketones, such as undergoing nucleophilic addition reactions. Additionally, the compound's unique structural features may contribute to its solubility and stability in various solvents. Overall, this substance represents a class of compounds that may possess interesting pharmacological properties, warranting further investigation in the fields of organic and medicinal chemistry.

Formula: C₂₂H₂₂F₃NO₃

InChI: InChI=1/C22H22F3NO3/c23-22(24,25)18-7-5-16(6-8-18)20(27)19-4-2-1-3-17(19)15-26-11-9-21(10-12-26)28-13-14-29-21/h1-8H,9-15H2

SMILES: c1ccc(c(c1)CN1CCC2(CC1)OCCO2)C(=O)c1ccc(cc1)C(F)(F)F