CAS 898756-35-9
:3-(1,3-Dioxan-2-yl)-1-(2-naphthalenyl)-1-propanone
Description:
3-(1,3-Dioxan-2-yl)-1-(2-naphthalenyl)-1-propanone, with the CAS number 898756-35-9, is an organic compound characterized by its unique structure that includes a dioxane ring and a naphthalene moiety. This compound typically exhibits properties common to ketones, such as being a polar substance due to the presence of the carbonyl group, which can engage in hydrogen bonding. The dioxane ring contributes to its stability and solubility in various organic solvents. The naphthalene group imparts aromatic characteristics, which can influence the compound's reactivity and interaction with other molecules. This compound may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or as an intermediate in organic synthesis. Its specific reactivity, stability, and potential applications would depend on the functional groups present and the overall molecular structure, making it a subject of interest for further research in material science and medicinal chemistry.
Formula:C17H18O3
InChI:InChI=1S/C17H18O3/c18-16(8-9-17-19-10-3-11-20-17)15-7-6-13-4-1-2-5-14(13)12-15/h1-2,4-7,12,17H,3,8-11H2
InChI key:InChIKey=DEXBVFCIYISFQO-UHFFFAOYSA-N
SMILES:C(CCC1OCCCO1)(=O)C2=CC3=C(C=C2)C=CC=C3
Synonyms:- 1-Propanone, 3-(1,3-dioxan-2-yl)-1-(2-naphthalenyl)-
- 3-(1,3-Dioxan-2-yl)-1-(2-naphthalenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.