CAS 898756-40-6

Methanone, [4-(1-azetidinylmethyl)phenyl](3-bromophenyl)-

Description:

Methanone, [4-(1-azetidinylmethyl)phenyl](3-bromophenyl)-, identified by CAS number 898756-40-6, is an organic compound characterized by its complex structure, which includes a methanone functional group and a phenyl ring substituted with a bromine atom. The presence of the azetidine moiety indicates that it contains a four-membered nitrogen-containing ring, contributing to its potential biological activity. This compound may exhibit properties typical of both ketones and aromatic compounds, such as reactivity in electrophilic substitution reactions and potential interactions with biological targets due to its nitrogen-containing ring. Its molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The bromine substituent may enhance its lipophilicity and influence its pharmacokinetic properties. However, specific characteristics such as solubility, melting point, and stability would require empirical data for precise evaluation. Overall, this compound represents a unique combination of functional groups that may confer interesting chemical and biological properties.

Formula: C₁₇H₁₆BrNO

InChI: InChI=1S/C17H16BrNO/c18-16-4-1-3-15(11-16)17(20)14-7-5-13(6-8-14)12-19-9-2-10-19/h1,3-8,11H,2,9-10,12H2

InChI key: InChIKey=IWGPKQJVMZUSQH-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Br)=CC=C1)C2=CC=C(CN3CCC3)C=C2

Synonyms:

• Methanone, [4-(1-azetidinylmethyl)phenyl](3-bromophenyl)-
• [4-(1-Azetidinylmethyl)phenyl](3-bromophenyl)methanone