CAS 898756-43-9

Methanone, [4-(1-azetidinylmethyl)phenyl](4-bromophenyl)-

Description:

Methanone, [4-(1-azetidinylmethyl)phenyl](4-bromophenyl)-, also known by its CAS number 898756-43-9, is an organic compound characterized by its complex structure that includes a methanone functional group and a phenyl ring substituted with a bromine atom. The presence of the azetidine ring indicates that it has a cyclic amine structure, which contributes to its potential biological activity. This compound may exhibit properties typical of both ketones and amines, such as reactivity in nucleophilic addition reactions and the ability to form hydrogen bonds. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the azetidine moiety, which is often associated with various biological activities. Additionally, the bromine substituent can enhance the compound's reactivity and influence its interaction with biological targets. As with many organic compounds, its physical properties, such as solubility and melting point, would depend on the specific molecular interactions and the environment in which it is studied.

Formula: C₁₇H₁₆BrNO

InChI: InChI=1S/C17H16BrNO/c18-16-8-6-15(7-9-16)17(20)14-4-2-13(3-5-14)12-19-10-1-11-19/h2-9H,1,10-12H2

InChI key: InChIKey=XJINXCZGPAMISD-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCC2)C=C1)C3=CC=C(Br)C=C3

Synonyms:

• Methanone, [4-(1-azetidinylmethyl)phenyl](4-bromophenyl)-
• [4-(1-Azetidinylmethyl)phenyl](4-bromophenyl)methanone