CymitQuimica logo

CAS 898756-46-2

:

Methanone, [4-(1-azetidinylmethyl)phenyl](3-chlorophenyl)-

Description:
Methanone, [4-(1-azetidinylmethyl)phenyl](3-chlorophenyl)-, identified by its CAS number 898756-46-2, is an organic compound characterized by its complex structure that includes a methanone functional group and a phenyl ring substituted with a 3-chlorophenyl moiety. The presence of the azetidine ring indicates that it has a cyclic amine structure, which contributes to its potential biological activity. This compound may exhibit properties typical of both ketones and amines, influencing its reactivity and interactions in various chemical environments. Its unique combination of functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The chlorophenyl group may enhance lipophilicity, affecting the compound's solubility and permeability. As with many organic compounds, its stability, reactivity, and biological activity would depend on various factors, including pH, temperature, and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C17H16ClNO
InChI:InChI=1/C17H16ClNO/c18-16-4-1-3-15(11-16)17(20)14-7-5-13(6-8-14)12-19-9-2-10-19/h1,3-8,11H,2,9-10,12H2
InChI key:InChIKey=BCUQUKINYKNDCJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Cl)=CC=C1)C2=CC=C(CN3CCC3)C=C2
Synonyms:
  • Methanone, [4-(1-azetidinylmethyl)phenyl](3-chlorophenyl)-
  • 4'-AZETIDINOMETHYL-3-CHLOROBENZOPHENONE
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.