CAS 898756-47-3
:4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(9-phenanthryl)butan-1-one
Description:
4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(9-phenanthryl)butan-1-one, with the CAS number 898756-47-3, is a synthetic organic compound characterized by its complex structure that includes a dioxane ring and a phenanthryl group. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It may possess moderate solubility in organic solvents, while its solubility in water is likely limited due to the hydrophobic nature of the phenanthryl moiety. The presence of the dioxane ring may contribute to its stability and influence its reactivity, particularly in nucleophilic substitution reactions. Additionally, this compound may have applications in organic synthesis, pharmaceuticals, or as a building block in material science, although specific applications would depend on further research and characterization. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C24H26O3
InChI:InChI=1/C24H26O3/c1-24(2)15-26-23(27-16-24)13-7-12-22(25)21-14-17-8-3-4-9-18(17)19-10-5-6-11-20(19)21/h3-6,8-11,14,23H,7,12-13,15-16H2,1-2H3
SMILES:CC1(C)COC(CCCC(=O)c2cc3ccccc3c3ccccc23)OC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.