CAS 898756-48-4

Methanone, (2,3-dichlorophenyl)[2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

Description:

Methanone, (2,3-dichlorophenyl)[2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique structural features, including a methanone functional group and a spirocyclic structure. The presence of dichlorophenyl groups indicates that the compound has two chlorine atoms substituted on a phenyl ring, which can influence its reactivity and physical properties. The spirocyclic component, featuring a dioxane and azaspiro structure, contributes to the compound's three-dimensional conformation, potentially affecting its biological activity and interactions. This compound may exhibit specific pharmacological properties due to its intricate arrangement of functional groups, making it of interest in medicinal chemistry. Its molecular weight, solubility, and stability would depend on the overall structure and substituents present. As with many synthetic organic compounds, understanding its characteristics requires consideration of its synthesis, potential applications, and safety profile in handling and usage.

Formula: C₂₁H₂₁Cl₂NO₃

InChI: InChI=1S/C21H21Cl2NO3/c22-18-7-3-6-17(19(18)23)20(25)16-5-2-1-4-15(16)14-24-10-8-21(9-11-24)26-12-13-27-21/h1-7H,8-14H2

InChI key: InChIKey=CVVCXJPWSQZXEO-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=C(C(=O)C4=C(Cl)C(Cl)=CC=C4)C=CC=C3

Synonyms:

• Methanone, (2,3-dichlorophenyl)[2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-