CymitQuimica logo

CAS 898756-50-8

:

5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(9-phenanthrenyl)-1-pentanone

Description:
5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(9-phenanthrenyl)-1-pentanone, with the CAS number 898756-50-8, is an organic compound characterized by its complex molecular structure, which includes a dioxane ring and a phenanthrene moiety. The presence of the dioxane ring contributes to its potential solubility in various organic solvents, while the phenanthrene group may impart unique photophysical properties, making it of interest in materials science and organic electronics. This compound likely exhibits a ketone functional group, which can participate in various chemical reactions, including nucleophilic additions and reductions. Its structural features suggest potential applications in fields such as organic synthesis, pharmaceuticals, or as a building block in the development of advanced materials. Additionally, the presence of bulky substituents like the dimethyl groups may influence its steric properties and reactivity. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its stability and potential toxicity.
Formula:C25H28O3
InChI:InChI=1S/C25H28O3/c1-25(2)16-27-24(28-17-25)14-8-7-13-23(26)22-15-18-9-3-4-10-19(18)20-11-5-6-12-21(20)22/h3-6,9-12,15,24H,7-8,13-14,16-17H2,1-2H3
InChI key:InChIKey=COZHCQXBYBQRRM-UHFFFAOYSA-N
SMILES:C(CCCCC1OCC(C)(C)CO1)(=O)C2=C3C(=C4C(=C2)C=CC=C4)C=CC=C3
Synonyms:
  • 5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(9-phenanthrenyl)-1-pentanone
  • 1-Pentanone, 5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(9-phenanthrenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.