CAS 898756-51-9

Methanone, (2,4-dichlorophenyl)[2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

Description:

Methanone, (2,4-dichlorophenyl)[2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique molecular structure, which includes a methanone functional group and a spirocyclic moiety. The presence of two chlorine atoms on the phenyl ring contributes to its reactivity and potential biological activity. The compound features a dioxane ring, which may enhance solubility and stability in various solvents. Its spirocyclic structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of such structures to interact with biological targets. The compound's molecular weight, solubility, and specific reactivity would depend on the arrangement of its functional groups and the overall three-dimensional conformation. As with many synthetic organic compounds, safety and handling precautions are essential, given the potential toxicity associated with halogenated compounds. Further studies would be necessary to elucidate its full chemical properties and potential applications in various fields.

Formula: C₂₁H₂₁Cl₂NO₃

InChI: InChI=1S/C21H21Cl2NO3/c22-16-5-6-18(19(23)13-16)20(25)17-4-2-1-3-15(17)14-24-9-7-21(8-10-24)26-11-12-27-21/h1-6,13H,7-12,14H2

InChI key: InChIKey=QESRHLKQOLIWEI-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=C(C(=O)C4=C(Cl)C=C(Cl)C=C4)C=CC=C3

Synonyms:

• Methanone, (2,4-dichlorophenyl)[2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-
• (2,4-Dichlorophenyl)[2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]methanone