CAS 898756-52-0
:[4-(azetidin-1-ylmethyl)phenyl]-(3-fluorophenyl)methanone
Description:
The chemical substance known as [4-(azetidin-1-ylmethyl)phenyl]-(3-fluorophenyl)methanone, with the CAS number 898756-52-0, is characterized by its complex molecular structure that includes an azetidine ring, a phenyl group, and a fluorinated phenyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and interactions. The presence of the azetidine ring suggests potential for biological activity, as such structures are often found in pharmaceuticals. The fluorine atom in the 3-position of the phenyl group can enhance lipophilicity and metabolic stability, making the compound of interest in medicinal chemistry. Additionally, the ketone functional group contributes to its reactivity, potentially allowing for further derivatization. Overall, this compound may exhibit unique physical and chemical properties, including solubility characteristics and stability under various conditions, which are essential for its application in research and development within the fields of organic and medicinal chemistry.
Formula:C17H16FNO
InChI:InChI=1/C17H16FNO/c18-16-4-1-3-15(11-16)17(20)14-7-5-13(6-8-14)12-19-9-2-10-19/h1,3-8,11H,2,9-10,12H2
SMILES:c1cc(cc(c1)F)C(=O)c1ccc(cc1)CN1CCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.