CymitQuimica logo

CAS 898756-53-1

:

3-(1,3-dioxan-2-yl)-1-(2-phenylphenyl)propan-1-one

Description:
3-(1,3-Dioxan-2-yl)-1-(2-phenylphenyl)propan-1-one, with the CAS number 898756-53-1, is an organic compound characterized by its complex structure that includes a dioxane ring and a phenyl-substituted propanone moiety. This compound typically exhibits properties associated with ketones, such as being a polar solvent and having a relatively high boiling point due to the presence of the dioxane ring, which can also influence its solubility in various organic solvents. The presence of the phenyl groups suggests potential for aromatic interactions, which may enhance its stability and reactivity in certain chemical environments. Additionally, the dioxane moiety can contribute to the compound's ability to participate in hydrogen bonding, affecting its physical properties and reactivity. This compound may be of interest in various fields, including organic synthesis and materials science, due to its unique structural features that could lend themselves to specific applications in pharmaceuticals or as intermediates in chemical reactions.
Formula:C19H20O3
InChI:InChI=1/C19H20O3/c20-18(11-12-19-21-13-6-14-22-19)17-10-5-4-9-16(17)15-7-2-1-3-8-15/h1-5,7-10,19H,6,11-14H2
SMILES:c1ccc(cc1)c1ccccc1C(=O)CCC1OCCCO1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.