CymitQuimica logo

CAS 898756-55-3

:

[4-(azetidin-1-ylmethyl)phenyl]-(4-fluorophenyl)methanone

Description:
The chemical substance known as [4-(azetidin-1-ylmethyl)phenyl]-(4-fluorophenyl)methanone, with the CAS number 898756-55-3, is characterized by its unique molecular structure, which includes an azetidine ring and a ketone functional group. This compound features a phenyl group substituted with a fluorine atom, enhancing its potential for biological activity. The presence of the azetidine moiety suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound's molecular weight, solubility, and stability can vary based on environmental conditions, influencing its reactivity and potential applications. Additionally, the presence of both electron-donating and electron-withdrawing groups in its structure may affect its electronic properties, making it a candidate for further studies in drug design and synthesis. Overall, this compound represents a complex structure with potential implications in various fields, including organic synthesis and pharmacology.
Formula:C17H16FNO
InChI:InChI=1/C17H16FNO/c18-16-8-6-15(7-9-16)17(20)14-4-2-13(3-5-14)12-19-10-1-11-19/h2-9H,1,10-12H2
SMILES:C1CN(C1)Cc1ccc(cc1)C(=O)c1ccc(cc1)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.