CAS 898756-56-4
:4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(2-phenylphenyl)butan-1-one
Description:
4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(2-phenylphenyl)butan-1-one, with the CAS number 898756-56-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a dioxane ring and a ketone functional group. This compound typically exhibits properties associated with organic ketones, such as being a potential solvent or intermediate in chemical synthesis. Its dioxane moiety may contribute to its solubility in organic solvents, while the presence of phenyl groups suggests potential aromatic interactions, which can influence its reactivity and stability. The compound may also exhibit specific biological activities, making it of interest in pharmaceutical or material science applications. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Safety data should be consulted for handling and usage, as organic compounds can vary widely in toxicity and environmental impact.
Formula:C22H26O3
InChI:InChI=1/C22H26O3/c1-22(2)15-24-21(25-16-22)14-8-13-20(23)19-12-7-6-11-18(19)17-9-4-3-5-10-17/h3-7,9-12,21H,8,13-16H2,1-2H3
SMILES:CC1(C)COC(CCCC(=O)c2ccccc2c2ccccc2)OC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.