CAS 898756-58-6
:Methanone, [4-(1-azetidinylmethyl)phenyl](2,3-dimethylphenyl)-
Description:
Methanone, [4-(1-azetidinylmethyl)phenyl](2,3-dimethylphenyl)-, also known by its CAS number 898756-58-6, is an organic compound characterized by its complex structure that includes a methanone functional group and a phenyl ring substituted with an azetidine moiety. This compound features a 4-(1-azetidinylmethyl)phenyl group, indicating the presence of a four-membered nitrogen-containing ring (azetidine) attached to a phenyl group, which contributes to its potential biological activity. Additionally, the presence of a 2,3-dimethylphenyl group suggests that the compound has multiple aromatic rings, which can influence its chemical reactivity and interactions. Methanones are generally known for their role in various chemical reactions, including nucleophilic attacks and as intermediates in organic synthesis. The specific arrangement of substituents in this compound may impart unique properties, such as solubility, stability, and reactivity, making it of interest in medicinal chemistry and material science. However, detailed studies would be necessary to fully understand its behavior and potential applications.
Formula:C19H21NO
InChI:InChI=1S/C19H21NO/c1-14-5-3-6-18(15(14)2)19(21)17-9-7-16(8-10-17)13-20-11-4-12-20/h3,5-10H,4,11-13H2,1-2H3
InChI key:InChIKey=CEKSJZYTASTONP-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C(C)=CC=C1)C2=CC=C(CN3CCC3)C=C2
Synonyms:- Methanone, [4-(1-azetidinylmethyl)phenyl](2,3-dimethylphenyl)-
- [4-(1-Azetidinylmethyl)phenyl](2,3-dimethylphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.