CAS 898756-59-7

1-[1,1′-Biphenyl]-2-yl-5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-pentanone

Description:

1-[1,1′-Biphenyl]-2-yl-5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-pentanone, with the CAS number 898756-59-7, is an organic compound characterized by its complex structure that includes a biphenyl moiety and a dioxane ring. This compound typically exhibits properties associated with ketones, such as being a polar solvent and having a relatively high boiling point due to its larger molecular size. The presence of the dioxane ring suggests potential for solubility in various organic solvents, while the biphenyl group may contribute to its stability and hydrophobic characteristics. Additionally, the compound may display interesting optical properties due to its conjugated system, making it potentially useful in applications such as organic electronics or as a precursor in synthetic chemistry. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular conformation. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.

Formula: C₂₃H₂₈O₃

InChI: InChI=1/C23H28O3/c1-23(2)16-25-22(26-17-23)15-9-8-14-21(24)20-13-7-6-12-19(20)18-10-4-3-5-11-18/h3-7,10-13,22H,8-9,14-17H2,1-2H3

InChI key: InChIKey=QBKJPNKDXJWLRO-UHFFFAOYSA-N

SMILES: C(CCCCC1OCC(C)(C)CO1)(=O)C2=C(C=CC=C2)C3=CC=CC=C3

Synonyms:

• 1-Pentanone, 1-[1,1′-biphenyl]-2-yl-5-(5,5-dimethyl-1,3-dioxan-2-yl)-
• 1-[1,1′-Biphenyl]-2-yl-5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-pentanone