CAS 898756-62-2

1-[1,1′-Biphenyl]-4-yl-3-(1,3-dioxan-2-yl)-1-propanone

Description:

1-[1,1′-Biphenyl]-4-yl-3-(1,3-dioxan-2-yl)-1-propanone, with the CAS number 898756-62-2, is an organic compound characterized by its complex structure that includes a biphenyl moiety and a dioxane ring. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic biphenyl component. The presence of the dioxane ring may impart some degree of stability and influence its reactivity, particularly in nucleophilic substitution reactions. Additionally, this compound may have applications in organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in various chemical reactions. As with many organic compounds, handling should be done with care, observing appropriate safety protocols to mitigate any potential hazards associated with its use.

Formula: C₁₉H₂₀O₃

InChI: InChI=1S/C19H20O3/c20-18(11-12-19-21-13-4-14-22-19)17-9-7-16(8-10-17)15-5-2-1-3-6-15/h1-3,5-10,19H,4,11-14H2

InChI key: InChIKey=NBXMKZZJQQOWRK-UHFFFAOYSA-N

SMILES: C(CCC1OCCCO1)(=O)C2=CC=C(C=C2)C3=CC=CC=C3

Synonyms:

• 1-Propanone, 1-[1,1′-biphenyl]-4-yl-3-(1,3-dioxan-2-yl)-
• 1-[1,1′-Biphenyl]-4-yl-3-(1,3-dioxan-2-yl)-1-propanone