CAS 898756-65-5
:1-[1,1′-Biphenyl]-4-yl-4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-butanone
Description:
1-[1,1′-Biphenyl]-4-yl-4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-butanone, identified by its CAS number 898756-65-5, is an organic compound characterized by its complex structure that includes a biphenyl moiety and a dioxane ring. This compound typically exhibits properties common to ketones, such as being a liquid at room temperature with a distinct odor. Its molecular structure suggests it may have moderate polarity due to the presence of the dioxane ring, which can influence its solubility in various solvents. The presence of the biphenyl group may impart certain aromatic characteristics, potentially affecting its reactivity and interactions with other chemical species. Additionally, the compound may exhibit interesting biological activities, making it of interest in pharmaceutical and materials science research. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications.
Formula:C22H26O3
InChI:InChI=1S/C22H26O3/c1-22(2)15-24-21(25-16-22)10-6-9-20(23)19-13-11-18(12-14-19)17-7-4-3-5-8-17/h3-5,7-8,11-14,21H,6,9-10,15-16H2,1-2H3
InChI key:InChIKey=AAQVERIESLUTEL-UHFFFAOYSA-N
SMILES:C(CCCC1OCC(C)(C)CO1)(=O)C2=CC=C(C=C2)C3=CC=CC=C3
Synonyms:- 1-Butanone, 1-[1,1′-biphenyl]-4-yl-4-(5,5-dimethyl-1,3-dioxan-2-yl)-
- 1-[1,1′-Biphenyl]-4-yl-4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-butanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.