CAS 898756-68-8

5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(4-phenylphenyl)pentan-1-one

Description:

5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-phenylphenyl)pentan-1-one, with the CAS number 898756-68-8, is a synthetic organic compound characterized by its complex molecular structure. It features a pentanone backbone, which is a five-carbon chain terminating in a ketone functional group. The presence of a dioxane ring contributes to its stability and solubility properties, while the phenyl groups enhance its aromatic characteristics, potentially influencing its reactivity and interaction with other substances. This compound may exhibit properties typical of ketones, such as being a polar solvent and participating in nucleophilic addition reactions. Its unique structure suggests potential applications in fields such as pharmaceuticals, materials science, or as a chemical intermediate. However, specific physical properties like melting point, boiling point, and solubility would require empirical data for precise characterization. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.

Formula: C₂₃H₂₈O₃

InChI: InChI=1/C23H28O3/c1-23(2)16-25-22(26-17-23)11-7-6-10-21(24)20-14-12-19(13-15-20)18-8-4-3-5-9-18/h3-5,8-9,12-15,22H,6-7,10-11,16-17H2,1-2H3

SMILES: CC1(C)COC(CCCCC(=O)c2ccc(cc2)c2ccccc2)OC1

Synonyms:

• 5-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)-4'-PHENYLVALEROPHENONE