CAS 898756-69-9
:Methanone, [4-(1-azetidinylmethyl)phenyl](3,4-dimethylphenyl)-
Description:
Methanone, [4-(1-azetidinylmethyl)phenyl](3,4-dimethylphenyl)-, also known by its CAS number 898756-69-9, is an organic compound characterized by its complex structure, which includes a methanone functional group and a phenyl ring substituted with an azetidine moiety. This compound features a phenyl group that is further substituted with a 3,4-dimethyl group, enhancing its hydrophobic characteristics. The presence of the azetidine ring introduces a cyclic amine structure, which can influence the compound's reactivity and potential biological activity. Methanones are generally known for their applications in pharmaceuticals and organic synthesis, often serving as intermediates in the production of more complex molecules. The specific arrangement of functional groups in this compound may contribute to its unique chemical properties, such as solubility, stability, and interaction with biological targets. As with many organic compounds, the precise characteristics, including melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which the compound is studied.
Formula:C19H21NO
InChI:InChI=1/C19H21NO/c1-14-4-7-18(12-15(14)2)19(21)17-8-5-16(6-9-17)13-20-10-3-11-20/h4-9,12H,3,10-11,13H2,1-2H3
InChI key:InChIKey=UIUKFSBAKYEOEZ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CN2CCC2)C=C1)C3=CC(C)=C(C)C=C3
Synonyms:- [4-(1-Azetidinylmethyl)phenyl](3,4-dimethylphenyl)methanone
- Methanone, [4-(1-azetidinylmethyl)phenyl](3,4-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.