CymitQuimica logo

CAS 898756-73-5

:

Methanone, [4-(1-azetidinylmethyl)phenyl](4-bromo-3-fluorophenyl)-

Description:
Methanone, [4-(1-azetidinylmethyl)phenyl](4-bromo-3-fluorophenyl)-, is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the azetidine moiety suggests that it may exhibit unique steric and electronic properties, potentially influencing its reactivity and interactions with biological targets. The compound features both bromine and fluorine substituents on the phenyl rings, which can significantly affect its lipophilicity, stability, and overall pharmacological profile. Such halogenated compounds are often of interest in medicinal chemistry due to their potential biological activity and ability to modulate the properties of the parent structure. Additionally, the presence of the azetidine ring may contribute to its conformational flexibility, which can be crucial for binding interactions in biological systems. Overall, this compound's unique combination of functional groups and structural features makes it a candidate for further investigation in various chemical and pharmaceutical applications.
Formula:C17H15BrFNO
InChI:InChI=1S/C17H15BrFNO/c18-15-7-6-14(10-16(15)19)17(21)13-4-2-12(3-5-13)11-20-8-1-9-20/h2-7,10H,1,8-9,11H2
InChI key:InChIKey=BIVBJYQDJXFMQW-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CN2CCC2)C=C1)C3=CC(F)=C(Br)C=C3
Synonyms:
  • Methanone, [4-(1-azetidinylmethyl)phenyl](4-bromo-3-fluorophenyl)-
  • [4-(1-Azetidinylmethyl)phenyl](4-bromo-3-fluorophenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.