CAS 898756-75-7
:[4-(azetidin-1-ylmethyl)phenyl]-(4-chloro-3-fluoro-phenyl)methanone
Description:
The chemical substance known as [4-(azetidin-1-ylmethyl)phenyl]-(4-chloro-3-fluoro-phenyl)methanone, with the CAS number 898756-75-7, is characterized by its complex structure that includes an azetidine ring, which is a four-membered saturated heterocycle containing one nitrogen atom. This compound features a phenyl group substituted with a methanone functional group, indicating the presence of a carbonyl group (C=O) bonded to a phenyl ring. The presence of both chloro and fluoro substituents on the phenyl ring suggests potential for varied reactivity and biological activity, as halogenated compounds often exhibit unique properties. The azetidine moiety may contribute to the compound's pharmacological profile, potentially influencing its interaction with biological targets. Overall, this compound's unique structural features may render it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific properties, such as solubility, stability, and reactivity, would depend on the overall molecular interactions and the environment in which it is studied.
Formula:C17H15ClFNO
InChI:InChI=1/C17H15ClFNO/c18-15-7-6-14(10-16(15)19)17(21)13-4-2-12(3-5-13)11-20-8-1-9-20/h2-7,10H,1,8-9,11H2
SMILES:C1CN(C1)Cc1ccc(cc1)C(=O)c1ccc(c(c1)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.