CAS 898756-77-9
:[4-(azetidin-1-ylmethyl)phenyl]-(3-chloro-4-fluoro-phenyl)methanone
Description:
The chemical substance known as [4-(azetidin-1-ylmethyl)phenyl]-(3-chloro-4-fluoro-phenyl)methanone, with the CAS number 898756-77-9, is a synthetic organic compound characterized by its complex structure, which includes an azetidine ring and multiple aromatic systems. This compound features a ketone functional group, which is indicative of its potential reactivity and applications in organic synthesis. The presence of halogen substituents, specifically chlorine and fluorine, on the phenyl rings can influence its electronic properties, making it of interest in medicinal chemistry and material science. The azetidine moiety may contribute to its biological activity, potentially affecting its interaction with biological targets. Additionally, the compound's solubility, stability, and reactivity can vary based on the functional groups present, which may also impact its pharmacokinetic properties if considered for pharmaceutical applications. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules, with potential implications in various fields, including drug development and chemical research.
Formula:C17H15ClFNO
InChI:InChI=1/C17H15ClFNO/c18-15-10-14(6-7-16(15)19)17(21)13-4-2-12(3-5-13)11-20-8-1-9-20/h2-7,10H,1,8-9,11H2
InChI key:InChIKey=VNCSTXNDYDISLN-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CN2CCC2)C=C1)C3=CC(Cl)=C(F)C=C3
Synonyms:- [4-(1-Azetidinylmethyl)phenyl](3-chloro-4-fluorophenyl)methanone
- Methanone, [4-(1-azetidinylmethyl)phenyl](3-chloro-4-fluorophenyl)-
- 4'-AZETIDINOMETHYL-3-CHLORO-4-FLUOROBENZOPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.