CymitQuimica logo

CAS 898756-79-1

:

[4-(azetidin-1-ylmethyl)phenyl]-(2-chlorophenyl)methanone

Description:
The chemical substance known as [4-(azetidin-1-ylmethyl)phenyl]-(2-chlorophenyl)methanone, with the CAS number 898756-79-1, is a synthetic organic compound characterized by its complex structure that includes an azetidine ring, a phenyl group, and a chlorophenyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which may influence its reactivity and interaction with biological targets. The presence of the azetidine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to mimic natural structures and interact with biological systems. The chlorophenyl group may enhance lipophilicity and influence the compound's pharmacokinetics. Additionally, the methanone functional group indicates the presence of a carbonyl, which can participate in various chemical reactions, including nucleophilic attacks. Overall, this compound's unique structural features may contribute to its potential utility in drug design and development, although specific biological activity and safety profiles would require further investigation.
Formula:C17H16ClNO
InChI:InChI=1/C17H16ClNO/c18-16-5-2-1-4-15(16)17(20)14-8-6-13(7-9-14)12-19-10-3-11-19/h1-2,4-9H,3,10-12H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.