CAS 898756-82-6

[4-(azetidin-1-ylmethyl)phenyl]-[2-(trifluoromethyl)phenyl]methanone

Description:

The chemical substance known as [4-(azetidin-1-ylmethyl)phenyl]-[2-(trifluoromethyl)phenyl]methanone, with the CAS number 898756-82-6, is a synthetic organic compound characterized by its complex structure, which includes an azetidine ring and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the trifluoromethyl group often enhances lipophilicity and can influence biological activity, making it of interest in medicinal chemistry. The azetidine moiety may impart unique steric and electronic properties, which can affect the compound's interaction with biological targets. Additionally, the methanone functional group suggests potential for reactivity in nucleophilic addition or substitution reactions. Overall, this compound's unique structural features may lead to diverse applications in pharmaceuticals or agrochemicals, although specific biological activities and applications would require further investigation through empirical studies.

Formula: C₁₈H₁₆F₃NO

InChI: InChI=1/C18H16F3NO/c19-18(20,21)16-5-2-1-4-15(16)17(23)14-8-6-13(7-9-14)12-22-10-3-11-22/h1-2,4-9H,3,10-12H2

SMILES: c1ccc(c(c1)C(=O)c1ccc(cc1)CN1CCC1)C(F)(F)F