CymitQuimica logo

CAS 898756-84-8

:

[4-(azetidin-1-ylmethyl)phenyl]-[3-(trifluoromethyl)phenyl]methanone

Description:
The chemical substance known as [4-(azetidin-1-ylmethyl)phenyl]-[3-(trifluoromethyl)phenyl]methanone, with the CAS number 898756-84-8, is characterized by its complex molecular structure, which includes an azetidine ring and a trifluoromethyl group. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the azetidine moiety suggests potential biological activity, as azetidines are often found in various pharmaceuticals. The trifluoromethyl group enhances lipophilicity and can influence the compound's pharmacokinetic properties, making it of interest in drug design. Additionally, the compound's phenyl rings provide sites for further functionalization, which can be exploited in synthetic pathways. Overall, this substance exemplifies the intersection of structural complexity and functional diversity, making it a candidate for further investigation in chemical research and development.
Formula:C18H16F3NO
InChI:InChI=1/C18H16F3NO/c19-18(20,21)16-4-1-3-15(11-16)17(23)14-7-5-13(6-8-14)12-22-9-2-10-22/h1,3-8,11H,2,9-10,12H2
SMILES:c1cc(cc(c1)C(F)(F)F)C(=O)c1ccc(cc1)CN1CCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.