CAS 898756-86-0

[4-(azetidin-1-ylmethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone

Description:

The chemical substance known as [4-(azetidin-1-ylmethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone, with the CAS number 898756-86-0, is characterized by its complex structure that includes both an azetidine ring and a trifluoromethyl group. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the azetidine moiety suggests potential biological activity, as azetidines are often explored for their pharmacological properties. The trifluoromethyl group is known to enhance lipophilicity and metabolic stability, making such compounds of interest in drug development. Additionally, the compound's phenyl rings provide sites for further functionalization, which can be advantageous in creating derivatives with tailored properties. Overall, this substance exemplifies the intersection of structural complexity and functional diversity, making it a candidate for further research in various chemical and pharmaceutical applications.

Formula: C₁₈H₁₆F₃NO

InChI: InChI=1/C18H16F3NO/c19-18(20,21)16-8-6-15(7-9-16)17(23)14-4-2-13(3-5-14)12-22-10-1-11-22/h2-9H,1,10-12H2

SMILES: C1CN(C1)Cc1ccc(cc1)C(=O)c1ccc(cc1)C(F)(F)F