CAS 898756-88-2
:1-(2,4-Dichlorophenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-butanone
Description:
1-(2,4-Dichlorophenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-butanone, with the CAS number 898756-88-2, is a synthetic organic compound characterized by its complex structure, which includes a dichlorophenyl group and a dioxane moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the dichlorophenyl group suggests that it may possess significant biological activity, possibly acting as a herbicide or pesticide. The dioxane ring can enhance solubility and stability, making the compound suitable for formulation in different solvents. Additionally, the butanone functional group indicates that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Overall, this compound's unique structural features and functional groups may lead to diverse reactivity and applications, although specific biological or chemical properties would require further investigation through empirical studies.
Formula:C16H20Cl2O3
InChI:InChI=1S/C16H20Cl2O3/c1-16(2)9-20-15(21-10-16)5-3-4-14(19)12-7-6-11(17)8-13(12)18/h6-8,15H,3-5,9-10H2,1-2H3
InChI key:InChIKey=RBYVDCVVFGIRHM-UHFFFAOYSA-N
SMILES:C(CCCC1OCC(C)(C)CO1)(=O)C2=C(Cl)C=C(Cl)C=C2
Synonyms:- 1-Butanone, 1-(2,4-dichlorophenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)-
- 1-(2,4-Dichlorophenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-butanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.