CAS 898756-89-3
:Methanone, [4-(1-azetidinylmethyl)phenyl](2-chloro-4-fluorophenyl)-
Description:
Methanone, [4-(1-azetidinylmethyl)phenyl](2-chloro-4-fluorophenyl)-, is a chemical compound characterized by its complex structure, which includes a methanone functional group and a phenyl ring substituted with both a chloro and a fluoro group. The presence of the azetidine moiety indicates that it contains a four-membered nitrogen-containing ring, contributing to its potential biological activity. This compound is likely to exhibit specific reactivity due to the electron-withdrawing effects of the chloro and fluoro substituents, which can influence its interaction with biological targets. Additionally, the azetidinylmethyl group may enhance its lipophilicity, affecting its solubility and permeability in biological systems. The compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, detailed studies on its pharmacokinetics, toxicity, and efficacy would be necessary to fully understand its properties and potential uses. As with many synthetic compounds, safety and handling precautions should be observed due to the presence of halogenated groups.
Formula:C17H15ClFNO
InChI:InChI=1/C17H15ClFNO/c18-16-10-14(19)6-7-15(16)17(21)13-4-2-12(3-5-13)11-20-8-1-9-20/h2-7,10H,1,8-9,11H2
InChI key:InChIKey=MMODNIQVJMYNSU-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Cl)C=C(F)C=C1)C2=CC=C(CN3CCC3)C=C2
Synonyms:- Methanone, [4-(1-azetidinylmethyl)phenyl](2-chloro-4-fluorophenyl)-
- [4-(1-Azetidinylmethyl)phenyl](2-chloro-4-fluorophenyl)methanone
- [4-(azetidin-1-ylmethyl)phenyl]-(2-chloro-4-fluorophenyl)methanone
- 4'-AZETIDINOMETHYL-2-CHLORO-4-FLUOROBENZOPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.