CAS 898756-91-7
:[4-(azetidin-1-ylmethyl)phenyl]-(3-chloro-5-fluoro-phenyl)methanone
Description:
The chemical substance known as [4-(azetidin-1-ylmethyl)phenyl]-(3-chloro-5-fluoro-phenyl)methanone, with the CAS number 898756-91-7, is characterized by its complex molecular structure, which includes an azetidine ring and multiple aromatic components. This compound features a ketone functional group, indicated by the methanone suffix, which contributes to its reactivity and potential applications in organic synthesis. The presence of halogen substituents, specifically chlorine and fluorine, suggests that it may exhibit unique electronic properties and enhanced biological activity. The azetidine moiety can influence the compound's pharmacokinetics and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's lipophilicity and solubility characteristics are likely influenced by its aromatic and aliphatic components, which can affect its behavior in various chemical environments. Overall, this substance may have potential applications in drug development or as a research tool in the study of chemical interactions and biological processes.
Formula:C17H15ClFNO
InChI:InChI=1/C17H15ClFNO/c18-15-8-14(9-16(19)10-15)17(21)13-4-2-12(3-5-13)11-20-6-1-7-20/h2-5,8-10H,1,6-7,11H2
SMILES:C1CN(C1)Cc1ccc(cc1)C(=O)c1cc(cc(c1)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.