CymitQuimica logo

CAS 898756-92-8

:

[4-(azetidin-1-ylmethyl)phenyl]-(4-chloro-2-fluoro-phenyl)methanone

Description:
The chemical substance known as [4-(azetidin-1-ylmethyl)phenyl]-(4-chloro-2-fluoro-phenyl)methanone, with the CAS number 898756-92-8, is characterized by its complex molecular structure, which includes an azetidine ring and multiple aromatic components. This compound features a ketone functional group, indicated by the "methanone" suffix, which contributes to its reactivity and potential applications in organic synthesis. The presence of halogen substituents, specifically chlorine and fluorine, on the phenyl rings can influence the compound's electronic properties, solubility, and biological activity. Such modifications often enhance the lipophilicity and metabolic stability of the molecule, making it of interest in pharmaceutical research. Additionally, the azetidine moiety may impart unique steric and electronic characteristics, potentially affecting the compound's interaction with biological targets. Overall, this substance exemplifies the intricate design often found in medicinal chemistry, where specific structural features are tailored to achieve desired pharmacological effects.
Formula:C17H15ClFNO
InChI:InChI=1/C17H15ClFNO/c18-14-6-7-15(16(19)10-14)17(21)13-4-2-12(3-5-13)11-20-8-1-9-20/h2-7,10H,1,8-9,11H2
SMILES:C1CN(C1)Cc1ccc(cc1)C(=O)c1ccc(cc1F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.