CAS 898756-94-0

Methanone, [4-(1-azetidinylmethyl)phenyl](2,3-dichlorophenyl)-

Description:

Methanone, [4-(1-azetidinylmethyl)phenyl](2,3-dichlorophenyl)-, also known by its CAS number 898756-94-0, is a chemical compound characterized by its complex structure that includes a methanone functional group and a phenyl ring substituted with dichlorine. The presence of the azetidine moiety indicates that it contains a four-membered nitrogen-containing ring, which can influence its biological activity and reactivity. This compound is likely to exhibit properties typical of ketones, such as being polar and capable of participating in various chemical reactions, including nucleophilic additions. The dichlorophenyl group may enhance its lipophilicity and potentially its biological interactions. Due to its structural features, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific information regarding its toxicity, stability, and reactivity would require further investigation through experimental studies and literature review.

Formula: C₁₇H₁₅Cl₂NO

InChI: InChI=1S/C17H15Cl2NO/c18-15-4-1-3-14(16(15)19)17(21)13-7-5-12(6-8-13)11-20-9-2-10-20/h1,3-8H,2,9-11H2

InChI key: InChIKey=YXGFMMZYUPWTRA-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C(Cl)=CC=C1)C2=CC=C(CN3CCC3)C=C2

Synonyms:

• Methanone, [4-(1-azetidinylmethyl)phenyl](2,3-dichlorophenyl)-