CAS 898756-96-2

[4-(azetidin-1-ylmethyl)phenyl]-(2,4-dichlorophenyl)methanone

Description:

The chemical substance known as [4-(azetidin-1-ylmethyl)phenyl]-(2,4-dichlorophenyl)methanone, with the CAS number 898756-96-2, is characterized by its complex molecular structure, which includes an azetidine ring and a dichlorophenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the azetidine moiety suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The dichlorophenyl group may enhance lipophilicity and influence the compound's pharmacokinetics. Additionally, the compound's functional groups can participate in various chemical reactions, making it a candidate for further synthetic modifications. Its stability, solubility, and specific interactions with biological systems would depend on the overall molecular conformation and the presence of substituents. As with many organic compounds, safety and handling precautions are essential when working with this substance in laboratory settings.

Formula: C₁₇H₁₅Cl₂NO

InChI: InChI=1/C17H15Cl2NO/c18-14-6-7-15(16(19)10-14)17(21)13-4-2-12(3-5-13)11-20-8-1-9-20/h2-7,10H,1,8-9,11H2