CAS 898756-98-4
:Methanone, [4-(1-azetidinylmethyl)phenyl](2,5-dichlorophenyl)-
Description:
Methanone, [4-(1-azetidinylmethyl)phenyl](2,5-dichlorophenyl)-, also known by its CAS number 898756-98-4, is an organic compound characterized by its complex structure that includes a methanone functional group and a phenyl ring substituted with dichloro groups. The presence of the azetidine moiety introduces a cyclic amine, which can influence the compound's reactivity and biological activity. This compound is likely to exhibit properties typical of ketones, such as being polar and capable of participating in various chemical reactions, including nucleophilic additions. The dichlorophenyl group may enhance its lipophilicity and potentially its pharmacological properties. Additionally, the azetidine ring can contribute to the compound's conformational flexibility and may play a role in interactions with biological targets. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, although specific biological activities would require further investigation.
Formula:C17H15Cl2NO
InChI:InChI=1S/C17H15Cl2NO/c18-14-6-7-16(19)15(10-14)17(21)13-4-2-12(3-5-13)11-20-8-1-9-20/h2-7,10H,1,8-9,11H2
InChI key:InChIKey=XPGXKYLUTZQLMZ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CN2CCC2)C=C1)C3=C(Cl)C=CC(Cl)=C3
Synonyms:- [4-(1-Azetidinylmethyl)phenyl](2,5-dichlorophenyl)methanone
- Methanone, [4-(1-azetidinylmethyl)phenyl](2,5-dichlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.