CAS 898757-00-1

Methanone, [4-(1-azetidinylmethyl)phenyl](3,4-dichlorophenyl)-

Description:

Methanone, [4-(1-azetidinylmethyl)phenyl](3,4-dichlorophenyl)-, also known by its CAS number 898757-00-1, is a chemical compound characterized by its unique structure that includes a methanone functional group and a phenyl ring substituted with dichlorine atoms. The presence of the azetidine moiety suggests potential biological activity, as azetidines are often found in various pharmacologically active compounds. This substance is likely to exhibit moderate to high lipophilicity due to its aromatic components, which can influence its solubility and permeability in biological systems. The dichlorophenyl group may enhance its reactivity and interaction with biological targets. Additionally, the compound's molecular structure indicates potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₇H₁₅Cl₂NO

InChI: InChI=1S/C17H15Cl2NO/c18-15-7-6-14(10-16(15)19)17(21)13-4-2-12(3-5-13)11-20-8-1-9-20/h2-7,10H,1,8-9,11H2

InChI key: InChIKey=ATBLVCWFYYERJX-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCC2)C=C1)C3=CC(Cl)=C(Cl)C=C3

Synonyms:

• Methanone, [4-(1-azetidinylmethyl)phenyl](3,4-dichlorophenyl)-
• [4-(1-Azetidinylmethyl)phenyl](3,4-dichlorophenyl)methanone