CymitQuimica logo

CAS 898757-04-5

:

1-(3,4-dichlorophenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one

Description:
1-(3,4-Dichlorophenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one, with the CAS number 898757-04-5, is a synthetic organic compound characterized by its complex structure, which includes a butanone backbone and a dichlorophenyl group. This compound features a dioxane ring, contributing to its unique chemical properties. It is typically classified as a ketone due to the presence of the carbonyl group (C=O) in its structure. The dichlorophenyl moiety suggests potential applications in pharmaceuticals or agrochemicals, as chlorinated aromatic compounds often exhibit biological activity. The presence of the dioxane ring may enhance solubility and stability in various solvents. Additionally, the compound's molecular structure indicates potential for interactions with biological systems, making it of interest in medicinal chemistry. However, specific safety and handling information, as well as detailed biological activity, would require further investigation and should be referenced from appropriate safety data sheets or scientific literature.
Formula:C16H20Cl2O3
InChI:InChI=1/C16H20Cl2O3/c1-16(2)9-20-15(21-10-16)5-3-4-14(19)11-6-7-12(17)13(18)8-11/h6-8,15H,3-5,9-10H2,1-2H3
SMILES:CC1(C)COC(CCCC(=O)c2ccc(c(c2)Cl)Cl)OC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.