CAS 898757-05-6
:Methanone, [4-(1-azetidinylmethyl)phenyl](3,4-difluorophenyl)-
Description:
Methanone, [4-(1-azetidinylmethyl)phenyl](3,4-difluorophenyl)-, also known by its CAS number 898757-05-6, is an organic compound characterized by its complex structure that includes a methanone functional group and a phenyl ring substituted with difluorine atoms. The presence of the azetidine moiety introduces a cyclic amine structure, which can influence the compound's reactivity and biological activity. This compound is likely to exhibit properties typical of ketones, such as being polar and capable of participating in various chemical reactions, including nucleophilic additions. The difluorophenyl group may enhance lipophilicity and affect the compound's interaction with biological targets. Overall, the unique combination of functional groups in this molecule suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such structural features can contribute to specific biological activities. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C17H15F2NO
InChI:InChI=1/C17H15F2NO/c18-15-7-6-14(10-16(15)19)17(21)13-4-2-12(3-5-13)11-20-8-1-9-20/h2-7,10H,1,8-9,11H2
InChI key:InChIKey=OAQIFKNRGHPMFG-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CN2CCC2)C=C1)C3=CC(F)=C(F)C=C3
Synonyms:- [4-(1-Azetidinylmethyl)phenyl](3,4-difluorophenyl)methanone
- Methanone, [4-(1-azetidinylmethyl)phenyl](3,4-difluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.