CAS 898757-07-8
:[4-(azetidin-1-ylmethyl)phenyl]-(3,5-difluorophenyl)methanone
Description:
The chemical substance known as [4-(azetidin-1-ylmethyl)phenyl]-(3,5-difluorophenyl)methanone, with the CAS number 898757-07-8, is a synthetic organic compound characterized by its complex structure, which includes an azetidine ring and a ketone functional group. This compound features a phenyl group substituted with difluorine atoms, contributing to its unique electronic properties and potential reactivity. The presence of the azetidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The difluorophenyl group may enhance lipophilicity and influence the compound's pharmacokinetic properties. Additionally, the compound's molecular structure indicates potential for various chemical reactions, including nucleophilic substitutions and cycloadditions. Overall, this compound exemplifies the intricate design often found in drug development, where specific functional groups are strategically incorporated to optimize biological activity and selectivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C17H15F2NO
InChI:InChI=1/C17H15F2NO/c18-15-8-14(9-16(19)10-15)17(21)13-4-2-12(3-5-13)11-20-6-1-7-20/h2-5,8-10H,1,6-7,11H2
SMILES:C1CN(C1)Cc1ccc(cc1)C(=O)c1cc(cc(c1)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.