CAS 898757-08-9

Methanone, [4-(1-azetidinylmethyl)phenyl](3,4,5-trifluorophenyl)-

Description:

Methanone, [4-(1-azetidinylmethyl)phenyl](3,4,5-trifluorophenyl)-, also known by its CAS number 898757-08-9, is a chemical compound characterized by its unique structure that includes a methanone functional group and a phenyl ring substituted with trifluoromethyl groups. The presence of the azetidine moiety introduces a cyclic amine structure, which can influence the compound's reactivity and biological activity. This compound is likely to exhibit properties typical of both ketones and aromatic compounds, including potential polar characteristics due to the trifluoromethyl groups, which can enhance lipophilicity and affect solubility in organic solvents. The trifluoromethyl groups are known to impart unique electronic properties, potentially making the compound useful in medicinal chemistry and material science. Additionally, the azetidine ring may contribute to the compound's ability to interact with biological targets, making it of interest in pharmacological research. Overall, this compound's distinct structural features suggest a range of potential applications in various fields, including drug development and synthetic chemistry.

Formula: C₁₇H₁₄F₃NO

InChI: InChI=1S/C17H14F3NO/c18-14-8-13(9-15(19)16(14)20)17(22)12-4-2-11(3-5-12)10-21-6-1-7-21/h2-5,8-9H,1,6-7,10H2

InChI key: InChIKey=MLWVPSWZWVKFHJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(F)C(F)=C1)C2=CC=C(CN3CCC3)C=C2

Synonyms:

• [4-(1-Azetidinylmethyl)phenyl](3,4,5-trifluorophenyl)methanone
• Methanone, [4-(1-azetidinylmethyl)phenyl](3,4,5-trifluorophenyl)-