CAS 898757-10-3

[4-(1-Azetidinylmethyl)phenyl]cyclopropylmethanone

Description:

[4-(1-Azetidinylmethyl)phenyl]cyclopropylmethanone, with the CAS number 898757-10-3, is a chemical compound characterized by its unique structural features, including a cyclopropyl group and an azetidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and interactions. The presence of the cyclopropyl group may impart strain, potentially affecting its stability and reactivity in chemical reactions. The azetidine ring contributes to the compound's overall three-dimensional shape, which can be crucial for biological activity and interactions with biological targets. Additionally, the phenyl group enhances the compound's lipophilicity, which may influence its solubility and permeability in biological systems. Overall, this compound's characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where its unique structure may confer specific biological activities. Further studies would be necessary to elucidate its precise properties and potential uses in various chemical and biological contexts.

Formula: C₁₄H₁₇NO

InChI: InChI=1S/C14H17NO/c16-14(13-6-7-13)12-4-2-11(3-5-12)10-15-8-1-9-15/h2-5,13H,1,6-10H2

InChI key: InChIKey=HCHOASKTNXRMIR-UHFFFAOYSA-N

SMILES: C(=O)(C1CC1)C2=CC=C(CN3CCC3)C=C2

Synonyms:

• Methanone, [4-(1-azetidinylmethyl)phenyl]cyclopropyl-
• [4-(1-Azetidinylmethyl)phenyl]cyclopropylmethanone