CAS 898757-12-5

[4-(1-Azetidinylmethyl)phenyl]cyclobutylmethanone

Description:

[4-(1-Azetidinylmethyl)phenyl]cyclobutylmethanone, with the CAS number 898757-12-5, is a chemical compound that features a cyclobutyl group and an azetidine moiety, which contribute to its unique structural and functional properties. This compound is characterized by its phenyl ring substituted with an azetidinylmethyl group, which can influence its biological activity and interaction with various receptors. The presence of the cyclobutyl group may impart strain and rigidity to the molecule, potentially affecting its conformational dynamics and reactivity. Such structural features often play a crucial role in the compound's pharmacological profile, making it of interest in medicinal chemistry and drug development. Additionally, the compound's properties, such as solubility, stability, and reactivity, can be influenced by the functional groups present and the overall molecular architecture. Understanding these characteristics is essential for exploring its potential applications in therapeutic contexts or as a research tool in chemical biology.

Formula: C₁₅H₁₉NO

InChI: InChI=1S/C15H19NO/c17-15(13-3-1-4-13)14-7-5-12(6-8-14)11-16-9-2-10-16/h5-8,13H,1-4,9-11H2

InChI key: InChIKey=FQGDDZUKYGUWMU-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCC2)C=C1)C3CCC3

Synonyms:

• Methanone, [4-(1-azetidinylmethyl)phenyl]cyclobutyl-
• [4-(1-Azetidinylmethyl)phenyl]cyclobutylmethanone