CAS 898757-14-7

[4-(azetidin-1-ylmethyl)phenyl]-cyclopentyl-methanone

Description:

The chemical substance known as [4-(azetidin-1-ylmethyl)phenyl]-cyclopentyl-methanone, with the CAS number 898757-14-7, is a synthetic organic compound that features a complex structure incorporating both aromatic and aliphatic components. It contains a phenyl ring substituted with an azetidine moiety, which contributes to its potential biological activity. The cyclopentyl group adds to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological membranes. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that can interact with various biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for confirmation of structure. As with many synthetic compounds, understanding its stability, reactivity, and potential applications in drug development or other fields would require further empirical studies and analysis.

Formula: C₁₆H₂₁NO

InChI: InChI=1/C16H21NO/c18-16(14-4-1-2-5-14)15-8-6-13(7-9-15)12-17-10-3-11-17/h6-9,14H,1-5,10-12H2