CAS 898757-18-1

Ethyl δ-oxo-4-pentylbenzenepentanoate

Description:

Ethyl δ-oxo-4-pentylbenzenepentanoate, identified by its CAS number 898757-18-1, is an organic compound characterized by its ester functional group, which is typical of many compounds in the ester category. This substance features a pentyl group, contributing to its hydrophobic properties, and a δ-oxo group, indicating the presence of a ketone functionality adjacent to the ester. The structure suggests that it may exhibit moderate to low solubility in water, while being more soluble in organic solvents due to its hydrophobic alkyl chains. Ethyl δ-oxo-4-pentylbenzenepentanoate may possess interesting chemical reactivity, particularly in reactions typical of esters, such as hydrolysis and transesterification. Its unique structure could also impart specific biological or pharmacological activities, making it a candidate for further research in medicinal chemistry or materials science. However, detailed studies on its physical properties, reactivity, and potential applications would be necessary to fully understand its characteristics and utility in various fields.

Formula: C₁₈H₂₆O₃

InChI: InChI=1S/C18H26O3/c1-3-5-6-8-15-11-13-16(14-12-15)17(19)9-7-10-18(20)21-4-2/h11-14H,3-10H2,1-2H3

InChI key: InChIKey=CWPFJBQUGDVZMN-UHFFFAOYSA-N

SMILES: C(CCCC(OCC)=O)(=O)C1=CC=C(CCCCC)C=C1

Synonyms:

• Ethyl δ-oxo-4-pentylbenzenepentanoate
• Benzenepentanoic acid, δ-oxo-4-pentyl-, ethyl ester